C16H30N2O — CID 66224958
2-(cyclopropylamino)-6-(3,3-dimethylbutoxy)-2-methylhexanenitrile (PubChem CID 66224958) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-(cyclopropylamino)-6-(3,3-dimethylbutoxy)-2-methylhexanenitrile.
| Compound Name | 2-(cyclopropylamino)-6-(3,3-dimethylbutoxy)-2-methylhexanenitrile |
|---|---|
| PubChem CID | 66224958 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-(cyclopropylamino)-6-(3,3-dimethylbutoxy)-2-methylhexanenitrile |
| SMILES | CC(C)(C)CCOCCCCC(C)(C#N)NC1CC1 |
| InChI | InChI=1S/C16H30N2O/c1-15(2,3)10-12-19-11-6-5-9-16(4,13-17)18-14-7-8-14/h14,18H,5-12H2,1-4H3 |
| InChIKey | YDNSQPQJSWJEPV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|