C12H22N2OS — CID 66225906
2-(3-amino-2-methylpropyl)sulfanyl-N,N-bis(prop-2-enyl)acetamide (PubChem CID 66225906) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-(3-amino-2-methylpropyl)sulfanyl-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(3-amino-2-methylpropyl)sulfanyl-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 66225906 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-(3-amino-2-methylpropyl)sulfanyl-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSCC(C)CN |
| InChI | InChI=1S/C12H22N2OS/c1-4-6-14(7-5-2)12(15)10-16-9-11(3)8-13/h4-5,11H,1-2,6-10,13H2,3H3 |
| InChIKey | GFQFGIRWWXBIPC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|