C14H27NS — CID 66226041
8-tert-butyl-2-methyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine (PubChem CID 66226041) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is 8-tert-butyl-2-methyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine.
| Compound Name | 8-tert-butyl-2-methyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
|---|---|
| PubChem CID | 66226041 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 8-tert-butyl-2-methyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
| SMILES | CC1CCNC2CCC(C(C)(C)C)CC2S1 |
| InChI | InChI=1S/C14H27NS/c1-10-7-8-15-12-6-5-11(14(2,3)4)9-13(12)16-10/h10-13,15H,5-9H2,1-4H3 |
| InChIKey | TXSCUVNCIARWCN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |