About 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane
3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane (PubChem CID 66226053) has the molecular formula C13H18BrNS
and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane |
| PubChem CID | 66226053 |
| Molecular Formula | C13H18BrNS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane |
| SMILES | CC1CCNC(c2ccc(Br)cc2)C(C)S1 |
| InChI | InChI=1S/C13H18BrNS/c1-9-7-8-15-13(10(2)16-9)11-3-5-12(14)6-4-11/h3-6,9-10,13,15H,7-8H2,1-2H3 |
| InChIKey | NXMRQEHEAZWISR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane?
The IUPAC name of 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane (CID 66226053) is 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane.
What is the SMILES notation for 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane?
The canonical SMILES for 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane is CC1CCNC(c2ccc(Br)cc2)C(C)S1.
What is the InChIKey of 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane?
The InChIKey is NXMRQEHEAZWISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrNS/c1-9-7-8-15-13(10(2)16-9)11-3-5-12(14)6-4-11/h3-6,9-10,13,15H,7-8H2,1-2H3.
What are the key properties of 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane?
3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane has a molecular weight of 300.27 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-2,7-dimethyl-1,4-thiazepane is sourced from PubChem (CID 66226053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).