C19H20N2OS — CID 6622665
4-benzyl-N-cyclopropyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 6622665) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-benzyl-N-cyclopropyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-cyclopropyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6622665 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-benzyl-N-cyclopropyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(c1)N(Cc1ccccc1)CCS2 |
| InChI | InChI=1S/C19H20N2OS/c22-19(20-16-7-8-16)15-6-9-18-17(12-15)21(10-11-23-18)13-14-4-2-1-3-5-14/h1-6,9,12,16H,7-8,10-11,13H2,(H,20,22) |
| InChIKey | LZCVYXYAMHBSLV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |