About 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane
2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane (PubChem CID 66226828) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane |
| PubChem CID | 66226828 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane |
| SMILES | COCc1ccccc1C1NCC(C)CS1 |
| InChI | InChI=1S/C13H19NOS/c1-10-7-14-13(16-9-10)12-6-4-3-5-11(12)8-15-2/h3-6,10,13-14H,7-9H2,1-2H3 |
| InChIKey | ANZZLPWOVAIYHW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane?
The IUPAC name of 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane (CID 66226828) is 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane.
What is the SMILES notation for 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane?
The canonical SMILES for 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane is COCc1ccccc1C1NCC(C)CS1.
What is the InChIKey of 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane?
The InChIKey is ANZZLPWOVAIYHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-10-7-14-13(16-9-10)12-6-4-3-5-11(12)8-15-2/h3-6,10,13-14H,7-9H2,1-2H3.
What are the key properties of 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane?
2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane has a molecular weight of 237.37 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methoxymethyl)phenyl]-5-methyl-1,3-thiazinane is sourced from PubChem (CID 66226828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).