About 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane
5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane (PubChem CID 66227054) has the molecular formula C10H15NS2
and a molecular weight of 213.37 g/mol. Its IUPAC name is 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane.
Molecular Properties
| Compound Name | 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane |
| PubChem CID | 66227054 |
| Molecular Formula | C10H15NS2 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane |
| SMILES | Cc1ccc(C2NCC(C)CS2)s1 |
| InChI | InChI=1S/C10H15NS2/c1-7-5-11-10(12-6-7)9-4-3-8(2)13-9/h3-4,7,10-11H,5-6H2,1-2H3 |
| InChIKey | OZZTVUBBPMXZQT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane?
The IUPAC name of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane (CID 66227054) is 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane.
What is the SMILES notation for 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane?
The canonical SMILES for 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane is Cc1ccc(C2NCC(C)CS2)s1.
What is the InChIKey of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane?
The InChIKey is OZZTVUBBPMXZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS2/c1-7-5-11-10(12-6-7)9-4-3-8(2)13-9/h3-4,7,10-11H,5-6H2,1-2H3.
What are the key properties of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane?
5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane has a molecular weight of 213.37 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazinane is sourced from PubChem (CID 66227054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).