C14H25NO2 — CID 66227074
N-[[5-(3,3-dimethylbutoxymethyl)furan-3-yl]methyl]ethanamine (PubChem CID 66227074) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[[5-(3,3-dimethylbutoxymethyl)furan-3-yl]methyl]ethanamine.
| Compound Name | N-[[5-(3,3-dimethylbutoxymethyl)furan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66227074 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[[5-(3,3-dimethylbutoxymethyl)furan-3-yl]methyl]ethanamine |
| SMILES | CCNCc1coc(COCCC(C)(C)C)c1 |
| InChI | InChI=1S/C14H25NO2/c1-5-15-9-12-8-13(17-10-12)11-16-7-6-14(2,3)4/h8,10,15H,5-7,9,11H2,1-4H3 |
| InChIKey | LZDTULNHKAXTLR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|