About 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide
4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 6622734) has the molecular formula C24H24N2OS
and a molecular weight of 388.54 g/mol. Its IUPAC name is 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| PubChem CID | 6622734 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc2c(c1)N(Cc1ccccc1)CCS2 |
| InChI | InChI=1S/C24H24N2OS/c27-24(25-14-13-19-7-3-1-4-8-19)21-11-12-23-22(17-21)26(15-16-28-23)18-20-9-5-2-6-10-20/h1-12,17H,13-16,18H2,(H,25,27) |
| InChIKey | XSRACVLGAPTIIO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
The IUPAC name of 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide (CID 6622734) is 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
What is the SMILES notation for 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
The canonical SMILES for 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide is O=C(NCCc1ccccc1)c1ccc2c(c1)N(Cc1ccccc1)CCS2.
What is the InChIKey of 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
The InChIKey is XSRACVLGAPTIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2OS/c27-24(25-14-13-19-7-3-1-4-8-19)21-11-12-23-22(17-21)26(15-16-28-23)18-20-9-5-2-6-10-20/h1-12,17H,13-16,18H2,(H,25,27).
What are the key properties of 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide has a molecular weight of 388.54 g/mol, XLogP of 4.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide is sourced from PubChem (CID 6622734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).