C16H23NS — CID 66227529
3-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine (PubChem CID 66227529) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 3-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine.
| Compound Name | 3-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
|---|---|
| PubChem CID | 66227529 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 3-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
| SMILES | CC1CNC2CCC(c3ccccc3)CC2SC1 |
| InChI | InChI=1S/C16H23NS/c1-12-10-17-15-8-7-14(9-16(15)18-11-12)13-5-3-2-4-6-13/h2-6,12,14-17H,7-11H2,1H3 |
| InChIKey | VESUWDYFCOOMHE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |