About 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane
6-methyl-3-(4-phenylphenyl)-1,4-thiazepane (PubChem CID 66227757) has the molecular formula C18H21NS
and a molecular weight of 283.44 g/mol. Its IUPAC name is 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane |
| PubChem CID | 66227757 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane |
| SMILES | CC1CNC(c2ccc(-c3ccccc3)cc2)CSC1 |
| InChI | InChI=1S/C18H21NS/c1-14-11-19-18(13-20-12-14)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-10,14,18-19H,11-13H2,1H3 |
| InChIKey | YCNMNIYPLJIVQT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane?
The IUPAC name of 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane (CID 66227757) is 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane.
What is the SMILES notation for 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane?
The canonical SMILES for 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane is CC1CNC(c2ccc(-c3ccccc3)cc2)CSC1.
What is the InChIKey of 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane?
The InChIKey is YCNMNIYPLJIVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NS/c1-14-11-19-18(13-20-12-14)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-10,14,18-19H,11-13H2,1H3.
What are the key properties of 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane?
6-methyl-3-(4-phenylphenyl)-1,4-thiazepane has a molecular weight of 283.44 g/mol, XLogP of 4.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(4-phenylphenyl)-1,4-thiazepane is sourced from PubChem (CID 66227757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).