C13H19NS — CID 66227818
2-(3,4-dimethylphenyl)-4,4-dimethyl-1,3-thiazolidine (PubChem CID 66227818) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-4,4-dimethyl-1,3-thiazolidine.
| Compound Name | 2-(3,4-dimethylphenyl)-4,4-dimethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 66227818 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-4,4-dimethyl-1,3-thiazolidine |
| SMILES | Cc1ccc(C2NC(C)(C)CS2)cc1C |
| InChI | InChI=1S/C13H19NS/c1-9-5-6-11(7-10(9)2)12-14-13(3,4)8-15-12/h5-7,12,14H,8H2,1-4H3 |
| InChIKey | OSIZFKSNZJDBOQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |