About 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile
3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile (PubChem CID 66228886) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile |
| PubChem CID | 66228886 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile |
| SMILES | CCC1CSC(c2cccc(C#N)c2)N1 |
| InChI | InChI=1S/C12H14N2S/c1-2-11-8-15-12(14-11)10-5-3-4-9(6-10)7-13/h3-6,11-12,14H,2,8H2,1H3 |
| InChIKey | BHLHOFCWCWXFNP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile?
The IUPAC name of 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile (CID 66228886) is 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile.
What is the SMILES notation for 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile?
The canonical SMILES for 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile is CCC1CSC(c2cccc(C#N)c2)N1.
What is the InChIKey of 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile?
The InChIKey is BHLHOFCWCWXFNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-2-11-8-15-12(14-11)10-5-3-4-9(6-10)7-13/h3-6,11-12,14H,2,8H2,1H3.
What are the key properties of 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile?
3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile has a molecular weight of 218.32 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethyl-1,3-thiazolidin-2-yl)benzonitrile is sourced from PubChem (CID 66228886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).