About 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine
5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine (PubChem CID 66229689) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine |
| PubChem CID | 66229689 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine |
| SMILES | CCOc1ccccc1C1CSCC(C)(C)N1 |
| InChI | InChI=1S/C14H21NOS/c1-4-16-13-8-6-5-7-11(13)12-9-17-10-14(2,3)15-12/h5-8,12,15H,4,9-10H2,1-3H3 |
| InChIKey | OYECIXDSSYZYGP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine?
The IUPAC name of 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine (CID 66229689) is 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine.
What is the SMILES notation for 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine?
The canonical SMILES for 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine is CCOc1ccccc1C1CSCC(C)(C)N1.
What is the InChIKey of 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine?
The InChIKey is OYECIXDSSYZYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-4-16-13-8-6-5-7-11(13)12-9-17-10-14(2,3)15-12/h5-8,12,15H,4,9-10H2,1-3H3.
What are the key properties of 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine?
5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine has a molecular weight of 251.39 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethoxyphenyl)-3,3-dimethylthiomorpholine is sourced from PubChem (CID 66229689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).