C14H21NO3S — CID 66229916
4,4-dimethyl-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidine (PubChem CID 66229916) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidine.
| Compound Name | 4,4-dimethyl-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 66229916 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4,4-dimethyl-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1cc(OC)c(C2NC(C)(C)CS2)c(OC)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-14(2)8-19-13(15-14)12-10(17-4)6-9(16-3)7-11(12)18-5/h6-7,13,15H,8H2,1-5H3 |
| InChIKey | IUSNTDFADATFIS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |