C17H12N2OS2 — CID 6622992
4-methyl-3-phenyl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one (PubChem CID 6622992) has the molecular formula C17H12N2OS2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-methyl-3-phenyl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one.
| Compound Name | 4-methyl-3-phenyl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one |
|---|---|
| PubChem CID | 6622992 |
| Molecular Formula | C17H12N2OS2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-methyl-3-phenyl-1-sulfanylidene-[1,3]thiazolo[3,4-a]quinazolin-5-one |
| SMILES | Cn1c(=O)c2ccccc2n2c(=S)sc(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H12N2OS2/c1-18-15-14(11-7-3-2-4-8-11)22-17(21)19(15)13-10-6-5-9-12(13)16(18)20/h2-10H,1H3 |
| InChIKey | JELPOMCGUUOYGR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|