About 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine
4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine (PubChem CID 66230382) has the molecular formula C14H21NOS
and a molecular weight of 251.40 g/mol. Its IUPAC name is 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine |
| PubChem CID | 66230382 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine |
| SMILES | CC(C)Oc1cccc(C2NC(C)(C)CS2)c1 |
| InChI | InChI=1S/C14H21NOS/c1-10(2)16-12-7-5-6-11(8-12)13-15-14(3,4)9-17-13/h5-8,10,13,15H,9H2,1-4H3 |
| InChIKey | QMKBEZFGLRCUMZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine?
The IUPAC name of 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine (CID 66230382) is 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine.
What is the SMILES notation for 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine?
The canonical SMILES for 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine is CC(C)Oc1cccc(C2NC(C)(C)CS2)c1.
What is the InChIKey of 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine?
The InChIKey is QMKBEZFGLRCUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-10(2)16-12-7-5-6-11(8-12)13-15-14(3,4)9-17-13/h5-8,10,13,15H,9H2,1-4H3.
What are the key properties of 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine?
4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine has a molecular weight of 251.40 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(3-propan-2-yloxyphenyl)-1,3-thiazolidine is sourced from PubChem (CID 66230382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).