About 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine
4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine (PubChem CID 66230622) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine |
| PubChem CID | 66230622 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine |
| SMILES | Cc1cccc(C2NC(C)(C)CS2)c1 |
| InChI | InChI=1S/C12H17NS/c1-9-5-4-6-10(7-9)11-13-12(2,3)8-14-11/h4-7,11,13H,8H2,1-3H3 |
| InChIKey | WYIMYTFXOBFPAO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine?
The IUPAC name of 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine (CID 66230622) is 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine.
What is the SMILES notation for 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine?
The canonical SMILES for 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine is Cc1cccc(C2NC(C)(C)CS2)c1.
What is the InChIKey of 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine?
The InChIKey is WYIMYTFXOBFPAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-9-5-4-6-10(7-9)11-13-12(2,3)8-14-11/h4-7,11,13H,8H2,1-3H3.
What are the key properties of 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine?
4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine has a molecular weight of 207.34 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(3-methylphenyl)-1,3-thiazolidine is sourced from PubChem (CID 66230622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).