C11H18F3NOS — CID 66231237
3-ethyl-7-(trifluoromethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide (PubChem CID 66231237) has the molecular formula C11H18F3NOS and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-ethyl-7-(trifluoromethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide.
| Compound Name | 3-ethyl-7-(trifluoromethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide |
|---|---|
| PubChem CID | 66231237 |
| Molecular Formula | C11H18F3NOS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3-ethyl-7-(trifluoromethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide |
| SMILES | CCC1CS(=O)C2CC(C(F)(F)F)CCC2N1 |
| InChI | InChI=1S/C11H18F3NOS/c1-2-8-6-17(16)10-5-7(11(12,13)14)3-4-9(10)15-8/h7-10,15H,2-6H2,1H3 |
| InChIKey | DXRWBYVTRQCUIS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |