C11H17NO2S — CID 66231336
3-(furan-2-yl)-2,5,5-trimethyl-1,4-thiazinane 1-oxide (PubChem CID 66231336) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-2,5,5-trimethyl-1,4-thiazinane 1-oxide.
| Compound Name | 3-(furan-2-yl)-2,5,5-trimethyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 66231336 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-(furan-2-yl)-2,5,5-trimethyl-1,4-thiazinane 1-oxide |
| SMILES | CC1C(c2ccco2)NC(C)(C)CS1=O |
| InChI | InChI=1S/C11H17NO2S/c1-8-10(9-5-4-6-14-9)12-11(2,3)7-15(8)13/h4-6,8,10,12H,7H2,1-3H3 |
| InChIKey | LFXFPOREZLBUEW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |