About 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine
2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine (PubChem CID 66231451) has the molecular formula C11H13ClFNS
and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine |
| PubChem CID | 66231451 |
| Molecular Formula | C11H13ClFNS |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine |
| SMILES | CCC1CSC(c2c(F)cccc2Cl)N1 |
| InChI | InChI=1S/C11H13ClFNS/c1-2-7-6-15-11(14-7)10-8(12)4-3-5-9(10)13/h3-5,7,11,14H,2,6H2,1H3 |
| InChIKey | MTUKZPPNFTZAPW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine?
The IUPAC name of 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine (CID 66231451) is 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine.
What is the SMILES notation for 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine?
The canonical SMILES for 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine is CCC1CSC(c2c(F)cccc2Cl)N1.
What is the InChIKey of 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine?
The InChIKey is MTUKZPPNFTZAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClFNS/c1-2-7-6-15-11(14-7)10-8(12)4-3-5-9(10)13/h3-5,7,11,14H,2,6H2,1H3.
What are the key properties of 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine?
2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine has a molecular weight of 245.75 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-6-fluorophenyl)-4-ethyl-1,3-thiazolidine is sourced from PubChem (CID 66231451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).