About 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine
2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine (PubChem CID 66231452) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine |
| PubChem CID | 66231452 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine |
| SMILES | CCC1CSC(C2CC=CCC2)N1 |
| InChI | InChI=1S/C11H19NS/c1-2-10-8-13-11(12-10)9-6-4-3-5-7-9/h3-4,9-12H,2,5-8H2,1H3 |
| InChIKey | HJBKXALEOVZEPC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine?
The IUPAC name of 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine (CID 66231452) is 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine.
What is the SMILES notation for 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine?
The canonical SMILES for 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine is CCC1CSC(C2CC=CCC2)N1.
What is the InChIKey of 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine?
The InChIKey is HJBKXALEOVZEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NS/c1-2-10-8-13-11(12-10)9-6-4-3-5-7-9/h3-4,9-12H,2,5-8H2,1H3.
What are the key properties of 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine?
2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine has a molecular weight of 197.35 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-3-en-1-yl-4-ethyl-1,3-thiazolidine is sourced from PubChem (CID 66231452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).