C10H19NOS — CID 66231469
3-ethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide (PubChem CID 66231469) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 3-ethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide.
| Compound Name | 3-ethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide |
|---|---|
| PubChem CID | 66231469 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-ethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide |
| SMILES | CCC1CS(=O)C2CCCCC2N1 |
| InChI | InChI=1S/C10H19NOS/c1-2-8-7-13(12)10-6-4-3-5-9(10)11-8/h8-11H,2-7H2,1H3 |
| InChIKey | BOZYNAGWUUJGFA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |