About 2-ethyl-5-methyl-1,4-thiazepane
2-ethyl-5-methyl-1,4-thiazepane (PubChem CID 66231722) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is 2-ethyl-5-methyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-1,4-thiazepane |
| PubChem CID | 66231722 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 2-ethyl-5-methyl-1,4-thiazepane |
| SMILES | CCC1CNC(C)CCS1 |
| InChI | InChI=1S/C8H17NS/c1-3-8-6-9-7(2)4-5-10-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | FBLBOHLHQNEOPY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-methyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-1,4-thiazepane?
The IUPAC name of 2-ethyl-5-methyl-1,4-thiazepane (CID 66231722) is 2-ethyl-5-methyl-1,4-thiazepane.
What is the SMILES notation for 2-ethyl-5-methyl-1,4-thiazepane?
The canonical SMILES for 2-ethyl-5-methyl-1,4-thiazepane is CCC1CNC(C)CCS1.
What is the InChIKey of 2-ethyl-5-methyl-1,4-thiazepane?
The InChIKey is FBLBOHLHQNEOPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS/c1-3-8-6-9-7(2)4-5-10-8/h7-9H,3-6H2,1-2H3.
What are the key properties of 2-ethyl-5-methyl-1,4-thiazepane?
2-ethyl-5-methyl-1,4-thiazepane has a molecular weight of 159.30 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-1,4-thiazepane is sourced from PubChem (CID 66231722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).