About 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane
2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane (PubChem CID 66231747) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane |
| PubChem CID | 66231747 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane |
| SMILES | COc1cccc(C2NC(C)CCS2)c1OC |
| InChI | InChI=1S/C13H19NO2S/c1-9-7-8-17-13(14-9)10-5-4-6-11(15-2)12(10)16-3/h4-6,9,13-14H,7-8H2,1-3H3 |
| InChIKey | OCQBLCMAIPGKCW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane?
The IUPAC name of 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane (CID 66231747) is 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane.
What is the SMILES notation for 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane?
The canonical SMILES for 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane is COc1cccc(C2NC(C)CCS2)c1OC.
What is the InChIKey of 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane?
The InChIKey is OCQBLCMAIPGKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-9-7-8-17-13(14-9)10-5-4-6-11(15-2)12(10)16-3/h4-6,9,13-14H,7-8H2,1-3H3.
What are the key properties of 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane?
2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane has a molecular weight of 253.37 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethoxyphenyl)-4-methyl-1,3-thiazinane is sourced from PubChem (CID 66231747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).