C22H21N3S — CID 6623204
4-ethyl-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]aniline (PubChem CID 6623204) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-ethyl-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]aniline.
| Compound Name | 4-ethyl-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 6623204 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-ethyl-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methyl]aniline |
| SMILES | CCc1ccc(NCc2cn(-c3ccccc3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C22H21N3S/c1-2-17-10-12-19(13-11-17)23-15-18-16-25(20-7-4-3-5-8-20)24-22(18)21-9-6-14-26-21/h3-14,16,23H,2,15H2,1H3 |
| InChIKey | NFUCYHOVNOKRTA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |