C10H20F3NO — CID 66232451
3-(3,3-dimethylbutoxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 66232451) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(3,3-dimethylbutoxy)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 66232451 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-(3,3-dimethylbutoxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(C)(C)CCOC(CCN)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NO/c1-9(2,3)5-7-15-8(4-6-14)10(11,12)13/h8H,4-7,14H2,1-3H3 |
| InChIKey | FZOZOPFEIPXXLR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |