C16H23NO2S — CID 66232868
4-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide (PubChem CID 66232868) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide.
| Compound Name | 4-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 66232868 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-methyl-8-phenyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide |
| SMILES | CC1CCS(=O)(=O)C2CC(c3ccccc3)CCC2N1 |
| InChI | InChI=1S/C16H23NO2S/c1-12-9-10-20(18,19)16-11-14(7-8-15(16)17-12)13-5-3-2-4-6-13/h2-6,12,14-17H,7-11H2,1H3 |
| InChIKey | QXPUULDUCWNJCA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |