C11H6Cl3NO — CID 66232986
5-chloro-2-(2,4-dichlorophenoxy)pyridine (PubChem CID 66232986) has the molecular formula C11H6Cl3NO and a molecular weight of 274.53 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenoxy)pyridine.
| Compound Name | 5-chloro-2-(2,4-dichlorophenoxy)pyridine |
|---|---|
| PubChem CID | 66232986 |
| Molecular Formula | C11H6Cl3NO |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)pyridine |
| SMILES | Clc1ccc(Oc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C11H6Cl3NO/c12-7-1-3-10(9(14)5-7)16-11-4-2-8(13)6-15-11/h1-6H |
| InChIKey | WISATVXQDWDYOW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |