C16H26FNO — CID 66233120
1-(3,3-dimethylbutoxy)-1-(2-fluorophenyl)butan-2-amine (PubChem CID 66233120) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-1-(2-fluorophenyl)butan-2-amine.
| Compound Name | 1-(3,3-dimethylbutoxy)-1-(2-fluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 66233120 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-1-(2-fluorophenyl)butan-2-amine |
| SMILES | CCC(N)C(OCCC(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C16H26FNO/c1-5-14(18)15(19-11-10-16(2,3)4)12-8-6-7-9-13(12)17/h6-9,14-15H,5,10-11,18H2,1-4H3 |
| InChIKey | AZKYFNWMMSTCMJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |