C11H18F3NS — CID 66233298
4-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine (PubChem CID 66233298) has the molecular formula C11H18F3NS and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine.
| Compound Name | 4-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
|---|---|
| PubChem CID | 66233298 |
| Molecular Formula | C11H18F3NS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
| SMILES | CC1CCSC2CC(C(F)(F)F)CCC2N1 |
| InChI | InChI=1S/C11H18F3NS/c1-7-4-5-16-10-6-8(11(12,13)14)2-3-9(10)15-7/h7-10,15H,2-6H2,1H3 |
| InChIKey | XQYAYJFPBHQHHV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |