C14H21NO2S — CID 66233319
3-(3,4-dimethylphenyl)-5-methyl-1,4-thiazepane 1,1-dioxide (PubChem CID 66233319) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-5-methyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 3-(3,4-dimethylphenyl)-5-methyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 66233319 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-5-methyl-1,4-thiazepane 1,1-dioxide |
| SMILES | Cc1ccc(C2CS(=O)(=O)CCC(C)N2)cc1C |
| InChI | InChI=1S/C14H21NO2S/c1-10-4-5-13(8-11(10)2)14-9-18(16,17)7-6-12(3)15-14/h4-5,8,12,14-15H,6-7,9H2,1-3H3 |
| InChIKey | NWXIQAKTAGHMFQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |