C9H17NOS — CID 66233532
4-methyl-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b][1,4]thiazepine 1-oxide (PubChem CID 66233532) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 4-methyl-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b][1,4]thiazepine 1-oxide.
| Compound Name | 4-methyl-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b][1,4]thiazepine 1-oxide |
|---|---|
| PubChem CID | 66233532 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-methyl-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b][1,4]thiazepine 1-oxide |
| SMILES | CC1CCS(=O)C2CCCC2N1 |
| InChI | InChI=1S/C9H17NOS/c1-7-5-6-12(11)9-4-2-3-8(9)10-7/h7-10H,2-6H2,1H3 |
| InChIKey | JTORWVQPCGWFJW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |