About 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine
5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine (PubChem CID 66233669) has the molecular formula C12H17ClN2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine.
Molecular Properties
| Compound Name | 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine |
| PubChem CID | 66233669 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine |
| SMILES | CC1(C)CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C12H17ClN2/c1-12(2)5-7-15(8-6-12)11-4-3-10(13)9-14-11/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | HSPJAIDQKHNQAV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine?
The IUPAC name of 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine (CID 66233669) is 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine.
What is the SMILES notation for 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine?
The canonical SMILES for 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine is CC1(C)CCN(c2ccc(Cl)cn2)CC1.
What is the InChIKey of 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine?
The InChIKey is HSPJAIDQKHNQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2/c1-12(2)5-7-15(8-6-12)11-4-3-10(13)9-14-11/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine?
5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine has a molecular weight of 224.73 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(4,4-dimethylpiperidin-1-yl)pyridine is sourced from PubChem (CID 66233669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).