About 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole
5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole (PubChem CID 66233884) has the molecular formula C15H9ClN2OS2
and a molecular weight of 332.84 g/mol. Its IUPAC name is 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole |
| PubChem CID | 66233884 |
| Molecular Formula | C15H9ClN2OS2 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole |
| SMILES | Cc1nc2c(cc(Oc3ccc(Cl)cn3)c3ccsc32)s1 |
| InChI | InChI=1S/C15H9ClN2OS2/c1-8-18-14-12(21-8)6-11(10-4-5-20-15(10)14)19-13-3-2-9(16)7-17-13/h2-7H,1H3 |
| InChIKey | ITPYKTXBFCXEBJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole?
The IUPAC name of 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole (CID 66233884) is 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole.
What is the SMILES notation for 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole?
The canonical SMILES for 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole is Cc1nc2c(cc(Oc3ccc(Cl)cn3)c3ccsc32)s1.
What is the InChIKey of 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole?
The InChIKey is ITPYKTXBFCXEBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClN2OS2/c1-8-18-14-12(21-8)6-11(10-4-5-20-15(10)14)19-13-3-2-9(16)7-17-13/h2-7H,1H3.
What are the key properties of 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole?
5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole has a molecular weight of 332.84 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-chloro-2-pyridinyl)oxy]-2-methylthieno[2,3-e][1,3]benzothiazole is sourced from PubChem (CID 66233884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).