C14H27BrO — CID 66234060
1-(bromomethyl)-1-(3,3-dimethylbutoxymethyl)cyclohexane (PubChem CID 66234060) has the molecular formula C14H27BrO and a molecular weight of 291.27 g/mol. Its IUPAC name is 1-(bromomethyl)-1-(3,3-dimethylbutoxymethyl)cyclohexane.
| Compound Name | 1-(bromomethyl)-1-(3,3-dimethylbutoxymethyl)cyclohexane |
|---|---|
| PubChem CID | 66234060 |
| Molecular Formula | C14H27BrO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(bromomethyl)-1-(3,3-dimethylbutoxymethyl)cyclohexane |
| SMILES | CC(C)(C)CCOCC1(CBr)CCCCC1 |
| InChI | InChI=1S/C14H27BrO/c1-13(2,3)9-10-16-12-14(11-15)7-5-4-6-8-14/h4-12H2,1-3H3 |
| InChIKey | LFAZKKOBAKURGA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|