C20H26N4O — CID 6623456
3-[3-[cyclohexyl(methyl)amino]propyl]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 6623456) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[3-[cyclohexyl(methyl)amino]propyl]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-[3-[cyclohexyl(methyl)amino]propyl]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 6623456 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-[3-[cyclohexyl(methyl)amino]propyl]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | CN(CCCn1cnc2c([nH]c3ccccc32)c1=O)C1CCCCC1 |
| InChI | InChI=1S/C20H26N4O/c1-23(15-8-3-2-4-9-15)12-7-13-24-14-21-18-16-10-5-6-11-17(16)22-19(18)20(24)25/h5-6,10-11,14-15,22H,2-4,7-9,12-13H2,1H3 |
| InChIKey | PJAYHZBWYHLMNG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |