About 3-(4-bromophenyl)-5-methyl-1,4-thiazepane
3-(4-bromophenyl)-5-methyl-1,4-thiazepane (PubChem CID 66234655) has the molecular formula C12H16BrNS
and a molecular weight of 286.24 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-methyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-5-methyl-1,4-thiazepane |
| PubChem CID | 66234655 |
| Molecular Formula | C12H16BrNS |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-(4-bromophenyl)-5-methyl-1,4-thiazepane |
| SMILES | CC1CCSCC(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C12H16BrNS/c1-9-6-7-15-8-12(14-9)10-2-4-11(13)5-3-10/h2-5,9,12,14H,6-8H2,1H3 |
| InChIKey | OILSCUJCSFWMFV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromophenyl)-5-methyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-5-methyl-1,4-thiazepane?
The IUPAC name of 3-(4-bromophenyl)-5-methyl-1,4-thiazepane (CID 66234655) is 3-(4-bromophenyl)-5-methyl-1,4-thiazepane.
What is the SMILES notation for 3-(4-bromophenyl)-5-methyl-1,4-thiazepane?
The canonical SMILES for 3-(4-bromophenyl)-5-methyl-1,4-thiazepane is CC1CCSCC(c2ccc(Br)cc2)N1.
What is the InChIKey of 3-(4-bromophenyl)-5-methyl-1,4-thiazepane?
The InChIKey is OILSCUJCSFWMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNS/c1-9-6-7-15-8-12(14-9)10-2-4-11(13)5-3-10/h2-5,9,12,14H,6-8H2,1H3.
What are the key properties of 3-(4-bromophenyl)-5-methyl-1,4-thiazepane?
3-(4-bromophenyl)-5-methyl-1,4-thiazepane has a molecular weight of 286.24 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-5-methyl-1,4-thiazepane is sourced from PubChem (CID 66234655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).