About 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide
2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide (PubChem CID 66234747) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide.
Molecular Properties
| Compound Name | 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide |
| PubChem CID | 66234747 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide |
| SMILES | [H]/N=C(\N)CC1(COCCC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O/c1-11(2,3)6-7-15-9-12(4-5-12)8-10(13)14/h4-9H2,1-3H3,(H3,13,14) |
| InChIKey | FBLSTOWZONKXFU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide?
The IUPAC name of 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide (CID 66234747) is 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide.
What is the SMILES notation for 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide?
The canonical SMILES for 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide is [H]/N=C(\N)CC1(COCCC(C)(C)C)CC1.
What is the InChIKey of 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide?
The InChIKey is FBLSTOWZONKXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-11(2,3)6-7-15-9-12(4-5-12)8-10(13)14/h4-9H2,1-3H3,(H3,13,14).
What are the key properties of 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide?
2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide has a molecular weight of 212.34 g/mol, XLogP of 2.55, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-dimethylbutoxymethyl)cyclopropyl]ethanimidamide is sourced from PubChem (CID 66234747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).