About 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid
4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid (PubChem CID 66235283) has the molecular formula C15H28N2O4
and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid |
| PubChem CID | 66235283 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)C(CCNC(=O)C1COCC1N)CCC(=O)O |
| InChI | InChI=1S/C15H28N2O4/c1-15(2,3)10(4-5-13(18)19)6-7-17-14(20)11-8-21-9-12(11)16/h10-12H,4-9,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | BGTFXQMXUBZACV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid?
The IUPAC name of 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid (CID 66235283) is 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid.
What is the SMILES notation for 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid?
The canonical SMILES for 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid is CC(C)(C)C(CCNC(=O)C1COCC1N)CCC(=O)O.
What is the InChIKey of 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid?
The InChIKey is BGTFXQMXUBZACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O4/c1-15(2,3)10(4-5-13(18)19)6-7-17-14(20)11-8-21-9-12(11)16/h10-12H,4-9,16H2,1-3H3,(H,17,20)(H,18,19).
What are the key properties of 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid?
4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid has a molecular weight of 300.40 g/mol, XLogP of 0.99, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(4-aminooxolane-3-carbonyl)amino]ethyl]-5,5-dimethylhexanoic acid is sourced from PubChem (CID 66235283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).