C12H21NO4S — CID 66235341
4-[(2-butylsulfanylacetyl)-methylamino]oxolane-3-carboxylic acid (PubChem CID 66235341) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is 4-[(2-butylsulfanylacetyl)-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2-butylsulfanylacetyl)-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66235341 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-[(2-butylsulfanylacetyl)-methylamino]oxolane-3-carboxylic acid |
| SMILES | CCCCSCC(=O)N(C)C1COCC1C(=O)O |
| InChI | InChI=1S/C12H21NO4S/c1-3-4-5-18-8-11(14)13(2)10-7-17-6-9(10)12(15)16/h9-10H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | MAXJQUPTOFEXHG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|