About 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide
4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide (PubChem CID 66235683) has the molecular formula C9H15F3N2O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide |
| PubChem CID | 66235683 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O3/c10-9(11,12)5-16-2-1-14-8(15)6-3-17-4-7(6)13/h6-7H,1-5,13H2,(H,14,15) |
| InChIKey | RPJCCWOTVHFZCQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide?
The IUPAC name of 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide (CID 66235683) is 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide.
What is the SMILES notation for 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide?
The canonical SMILES for 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide is NC1COCC1C(=O)NCCOCC(F)(F)F.
What is the InChIKey of 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide?
The InChIKey is RPJCCWOTVHFZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c10-9(11,12)5-16-2-1-14-8(15)6-3-17-4-7(6)13/h6-7H,1-5,13H2,(H,14,15).
What are the key properties of 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide?
4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide has a molecular weight of 256.22 g/mol, XLogP of -0.34, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide is sourced from PubChem (CID 66235683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).