About (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone
(5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone (PubChem CID 6623577) has the molecular formula C16H15NO3S2
and a molecular weight of 333.43 g/mol. Its IUPAC name is (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 6623577 |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc2c(s1)-c1ccccc1S(=O)(=O)C2)N1CCCC1 |
| InChI | InChI=1S/C16H15NO3S2/c18-16(17-7-3-4-8-17)13-9-11-10-22(19,20)14-6-2-1-5-12(14)15(11)21-13/h1-2,5-6,9H,3-4,7-8,10H2 |
| InChIKey | IAHXMYMZSMTYCL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone?
The IUPAC name of (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone (CID 6623577) is (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone is O=C(c1cc2c(s1)-c1ccccc1S(=O)(=O)C2)N1CCCC1.
What is the InChIKey of (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone?
The InChIKey is IAHXMYMZSMTYCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3S2/c18-16(17-7-3-4-8-17)13-9-11-10-22(19,20)14-6-2-1-5-12(14)15(11)21-13/h1-2,5-6,9H,3-4,7-8,10H2.
What are the key properties of (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone?
(5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone has a molecular weight of 333.43 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 6623577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).