About 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine
4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine (PubChem CID 66236109) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine.
Molecular Properties
| Compound Name | 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine |
| PubChem CID | 66236109 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine |
| SMILES | CC1CN(CC2COCC2N)C(C)CO1 |
| InChI | InChI=1S/C11H22N2O2/c1-8-5-15-9(2)3-13(8)4-10-6-14-7-11(10)12/h8-11H,3-7,12H2,1-2H3 |
| InChIKey | CBOAGUJLMMQARH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine?
The IUPAC name of 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine (CID 66236109) is 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine.
What is the SMILES notation for 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine?
The canonical SMILES for 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine is CC1CN(CC2COCC2N)C(C)CO1.
What is the InChIKey of 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine?
The InChIKey is CBOAGUJLMMQARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-8-5-15-9(2)3-13(8)4-10-6-14-7-11(10)12/h8-11H,3-7,12H2,1-2H3.
What are the key properties of 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine?
4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine has a molecular weight of 214.31 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-amine is sourced from PubChem (CID 66236109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).