About 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide
4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide (PubChem CID 66236302) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide |
| PubChem CID | 66236302 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)C2COCC2N)CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-13(2)3-5-14(18,6-4-13)9-16-12(17)10-7-19-8-11(10)15/h10-11,18H,3-9,15H2,1-2H3,(H,16,17) |
| InChIKey | ZGHLGOKHLJWMLU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide?
The IUPAC name of 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide (CID 66236302) is 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide.
What is the SMILES notation for 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide?
The canonical SMILES for 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide is CC1(C)CCC(O)(CNC(=O)C2COCC2N)CC1.
What is the InChIKey of 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide?
The InChIKey is ZGHLGOKHLJWMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-13(2)3-5-14(18,6-4-13)9-16-12(17)10-7-19-8-11(10)15/h10-11,18H,3-9,15H2,1-2H3,(H,16,17).
What are the key properties of 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide?
4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide has a molecular weight of 270.37 g/mol, XLogP of 0.41, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]oxolane-3-carboxamide is sourced from PubChem (CID 66236302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).