About 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine
4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine (PubChem CID 66236321) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine.
Molecular Properties
| Compound Name | 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine |
| PubChem CID | 66236321 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine |
| SMILES | CC(N(C)CC1COCC1N)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-9(12(2,3)4)14(5)6-10-7-15-8-11(10)13/h9-11H,6-8,13H2,1-5H3 |
| InChIKey | UDGYAXNJBKFNEA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine?
The IUPAC name of 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine (CID 66236321) is 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine.
What is the SMILES notation for 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine?
The canonical SMILES for 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine is CC(N(C)CC1COCC1N)C(C)(C)C.
What is the InChIKey of 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine?
The InChIKey is UDGYAXNJBKFNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-9(12(2,3)4)14(5)6-10-7-15-8-11(10)13/h9-11H,6-8,13H2,1-5H3.
What are the key properties of 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine?
4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine has a molecular weight of 214.35 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]oxolan-3-amine is sourced from PubChem (CID 66236321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).