C26H28N4O2 — CID 6623641
2-(5-benzyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 6623641) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-(5-benzyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-(5-benzyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 6623641 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-(5-benzyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)Cn2ncc3c4ccccc4n(Cc4ccccc4)c3c2=O)CC1 |
| InChI | InChI=1S/C26H28N4O2/c1-18-11-13-20(14-12-18)28-24(31)17-30-26(32)25-22(15-27-30)21-9-5-6-10-23(21)29(25)16-19-7-3-2-4-8-19/h2-10,15,18,20H,11-14,16-17H2,1H3,(H,28,31) |
| InChIKey | GWYDEFDOHMFLFV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |