About 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one
2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one (PubChem CID 6623699) has the molecular formula C19H16N4O
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one.
Molecular Properties
| Compound Name | 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one |
| PubChem CID | 6623699 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one |
| SMILES | Cc1ccc2nc3ccc(NCc4ccccc4)nn3c(=O)c2c1 |
| InChI | InChI=1S/C19H16N4O/c1-13-7-8-16-15(11-13)19(24)23-18(21-16)10-9-17(22-23)20-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,20,22) |
| InChIKey | JPTBBFXHINMZOY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one?
The IUPAC name of 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one (CID 6623699) is 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one.
What is the SMILES notation for 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one?
The canonical SMILES for 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one is Cc1ccc2nc3ccc(NCc4ccccc4)nn3c(=O)c2c1.
What is the InChIKey of 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one?
The InChIKey is JPTBBFXHINMZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O/c1-13-7-8-16-15(11-13)19(24)23-18(21-16)10-9-17(22-23)20-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,20,22).
What are the key properties of 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one?
2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one has a molecular weight of 316.36 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)-8-methylpyridazino[6,1-b]quinazolin-10-one is sourced from PubChem (CID 6623699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).