About 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide
4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide (PubChem CID 66237461) has the molecular formula C9H18N2O4
and a molecular weight of 218.25 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide |
| PubChem CID | 66237461 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H18N2O4/c10-8-6-15-5-7(8)9(14)11(1-3-12)2-4-13/h7-8,12-13H,1-6,10H2 |
| InChIKey | ZFEQNLLLQKQISQ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide?
The IUPAC name of 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide (CID 66237461) is 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide.
What is the SMILES notation for 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide?
The canonical SMILES for 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide is NC1COCC1C(=O)N(CCO)CCO.
What is the InChIKey of 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide?
The InChIKey is ZFEQNLLLQKQISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4/c10-8-6-15-5-7(8)9(14)11(1-3-12)2-4-13/h7-8,12-13H,1-6,10H2.
What are the key properties of 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide?
4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide has a molecular weight of 218.25 g/mol, XLogP of -2.23, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N-bis(2-hydroxyethyl)oxolane-3-carboxamide is sourced from PubChem (CID 66237461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).