About N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide
N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 6623754) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide |
| PubChem CID | 6623754 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1nn(C)c2c1COc1ccccc1-2 |
| InChI | InChI=1S/C16H16N4O2/c1-19(9-5-8-17)16(21)14-12-10-22-13-7-4-3-6-11(13)15(12)20(2)18-14/h3-4,6-7H,5,9-10H2,1-2H3 |
| InChIKey | BBQGBHZYAZSLAT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
The IUPAC name of N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide (CID 6623754) is N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide.
What is the SMILES notation for N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
The canonical SMILES for N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide is CN(CCC#N)C(=O)c1nn(C)c2c1COc1ccccc1-2.
What is the InChIKey of N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
The InChIKey is BBQGBHZYAZSLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-19(9-5-8-17)16(21)14-12-10-22-13-7-4-3-6-11(13)15(12)20(2)18-14/h3-4,6-7H,5,9-10H2,1-2H3.
What are the key properties of N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide has a molecular weight of 296.33 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide is sourced from PubChem (CID 6623754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).